C18H20O3 — CID 11277585
(7S,7aR)-7-cyclopropyl-4,5-dimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one (PubChem CID 11277585) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (7S,7aR)-7-cyclopropyl-4,5-dimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one.
| Compound Name | (7S,7aR)-7-cyclopropyl-4,5-dimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one |
|---|---|
| PubChem CID | 11277585 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (7S,7aR)-7-cyclopropyl-4,5-dimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one |
| SMILES | CC1O[C@@H](C2CC2)[C@@H]2OC(=O)C(c3ccccc3)=C2C1C |
| InChI | InChI=1S/C18H20O3/c1-10-11(2)20-16(13-8-9-13)17-14(10)15(18(19)21-17)12-6-4-3-5-7-12/h3-7,10-11,13,16-17H,8-9H2,1-2H3/t10?,11?,16-,17+/m0/s1 |
| InChIKey | ICQDBVQPGOCDLM-JRIFGSMTSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |