C21H26OSi2 — CID 12994941
(2,2-diphenyl-4,5,6,6a-tetrahydrocyclopenta[d]oxasilol-3-yl)-trimethylsilane (PubChem CID 12994941) has the molecular formula C21H26OSi2 and a molecular weight of 350.61 g/mol. Its IUPAC name is (2,2-diphenyl-4,5,6,6a-tetrahydrocyclopenta[d]oxasilol-3-yl)-trimethylsilane.
| Compound Name | (2,2-diphenyl-4,5,6,6a-tetrahydrocyclopenta[d]oxasilol-3-yl)-trimethylsilane |
|---|---|
| PubChem CID | 12994941 |
| Molecular Formula | C21H26OSi2 |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (2,2-diphenyl-4,5,6,6a-tetrahydrocyclopenta[d]oxasilol-3-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C2CCCC2O[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26OSi2/c1-23(2,3)21-19-15-10-16-20(19)22-24(21,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,20H,10,15-16H2,1-3H3 |
| InChIKey | OYUDWSMRPKUYBH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|