C15H22Si — CID 10421400
dimethyl-(3-methylcyclohex-2-en-1-yl)-phenylsilane (PubChem CID 10421400) has the molecular formula C15H22Si and a molecular weight of 230.43 g/mol. Its IUPAC name is dimethyl-(3-methylcyclohex-2-en-1-yl)-phenylsilane.
| Compound Name | dimethyl-(3-methylcyclohex-2-en-1-yl)-phenylsilane |
|---|---|
| PubChem CID | 10421400 |
| Molecular Formula | C15H22Si |
| Molecular Weight | 230.43 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | dimethyl-(3-methylcyclohex-2-en-1-yl)-phenylsilane |
| SMILES | CC1=CC([Si](C)(C)c2ccccc2)CCC1 |
| InChI | InChI=1S/C15H22Si/c1-13-8-7-11-15(12-13)16(2,3)14-9-5-4-6-10-14/h4-6,9-10,12,15H,7-8,11H2,1-3H3 |
| InChIKey | YLHNSELZHYBWHM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|