C22H30OSi2 — CID 11349127
[3-[dimethyl(phenyl)silyl]cyclohexen-1-yl]oxy-dimethyl-phenylsilane (PubChem CID 11349127) has the molecular formula C22H30OSi2 and a molecular weight of 366.65 g/mol. Its IUPAC name is [3-[dimethyl(phenyl)silyl]cyclohexen-1-yl]oxy-dimethyl-phenylsilane.
| Compound Name | [3-[dimethyl(phenyl)silyl]cyclohexen-1-yl]oxy-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11349127 |
| Molecular Formula | C22H30OSi2 |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [3-[dimethyl(phenyl)silyl]cyclohexen-1-yl]oxy-dimethyl-phenylsilane |
| SMILES | C[Si](C)(OC1=CC([Si](C)(C)c2ccccc2)CCC1)c1ccccc1 |
| InChI | InChI=1S/C22H30OSi2/c1-24(2,20-13-7-5-8-14-20)22-17-11-12-19(18-22)23-25(3,4)21-15-9-6-10-16-21/h5-10,13-16,18,22H,11-12,17H2,1-4H3 |
| InChIKey | AGLBTUBJBTULQP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|