C18H24OSi — CID 134901133
(4R,4aR)-4-[dimethyl(phenyl)silyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (PubChem CID 134901133) has the molecular formula C18H24OSi and a molecular weight of 284.47 g/mol. Its IUPAC name is (4R,4aR)-4-[dimethyl(phenyl)silyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
| Compound Name | (4R,4aR)-4-[dimethyl(phenyl)silyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 134901133 |
| Molecular Formula | C18H24OSi |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4R,4aR)-4-[dimethyl(phenyl)silyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1CC(=O)C=C2CCCC[C@H]21 |
| InChI | InChI=1S/C18H24OSi/c1-20(2,16-9-4-3-5-10-16)18-13-15(19)12-14-8-6-7-11-17(14)18/h3-5,9-10,12,17-18H,6-8,11,13H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | CCEDQPTVIBTCIA-QZTJIDSGSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|