C20H30O2Si — CID 11739024
(5S)-3-[dimethyl(phenyl)silyl]-5-methyl-2-(oxan-2-yl)cyclohexan-1-one (PubChem CID 11739024) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (5S)-3-[dimethyl(phenyl)silyl]-5-methyl-2-(oxan-2-yl)cyclohexan-1-one.
| Compound Name | (5S)-3-[dimethyl(phenyl)silyl]-5-methyl-2-(oxan-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11739024 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (5S)-3-[dimethyl(phenyl)silyl]-5-methyl-2-(oxan-2-yl)cyclohexan-1-one |
| SMILES | C[C@H]1CC(=O)C(C2CCCCO2)C([Si](C)(C)c2ccccc2)C1 |
| InChI | InChI=1S/C20H30O2Si/c1-15-13-17(21)20(18-11-7-8-12-22-18)19(14-15)23(2,3)16-9-5-4-6-10-16/h4-6,9-10,15,18-20H,7-8,11-14H2,1-3H3/t15-,18?,19?,20?/m0/s1 |
| InChIKey | AGTCJVJJQYACIH-HFHZODOMSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|