C14H20O2Si — CID 134948232
(4R,5S)-4-[dimethyl(phenyl)silyl]-5-ethyloxolan-2-one (PubChem CID 134948232) has the molecular formula C14H20O2Si and a molecular weight of 248.40 g/mol. Its IUPAC name is (4R,5S)-4-[dimethyl(phenyl)silyl]-5-ethyloxolan-2-one.
| Compound Name | (4R,5S)-4-[dimethyl(phenyl)silyl]-5-ethyloxolan-2-one |
|---|---|
| PubChem CID | 134948232 |
| Molecular Formula | C14H20O2Si |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (4R,5S)-4-[dimethyl(phenyl)silyl]-5-ethyloxolan-2-one |
| SMILES | CC[C@@H]1OC(=O)C[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H20O2Si/c1-4-12-13(10-14(15)16-12)17(2,3)11-8-6-5-7-9-11/h5-9,12-13H,4,10H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | QOJSGFPDFFDZRF-QWHCGFSZSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|