C15H22O2Si — CID 10264713
(4S,5R)-4-[[dimethyl(phenyl)silyl]methyl]-5-ethyloxolan-2-one (PubChem CID 10264713) has the molecular formula C15H22O2Si and a molecular weight of 262.42 g/mol. Its IUPAC name is (4S,5R)-4-[[dimethyl(phenyl)silyl]methyl]-5-ethyloxolan-2-one.
| Compound Name | (4S,5R)-4-[[dimethyl(phenyl)silyl]methyl]-5-ethyloxolan-2-one |
|---|---|
| PubChem CID | 10264713 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (4S,5R)-4-[[dimethyl(phenyl)silyl]methyl]-5-ethyloxolan-2-one |
| SMILES | CC[C@H]1OC(=O)C[C@@H]1C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H22O2Si/c1-4-14-12(10-15(16)17-14)11-18(2,3)13-8-6-5-7-9-13/h5-9,12,14H,4,10-11H2,1-3H3/t12-,14-/m1/s1 |
| InChIKey | WXULVWMVAXTAMP-TZMCWYRMSA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|