C32H42O2Si2 — CID 11318263
(3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3-butyl-5-[[dimethyl(phenyl)silyl]methyl]oxolan-2-one (PubChem CID 11318263) has the molecular formula C32H42O2Si2 and a molecular weight of 514.86 g/mol. Its IUPAC name is (3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3-butyl-5-[[dimethyl(phenyl)silyl]methyl]oxolan-2-one.
| Compound Name | (3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3-butyl-5-[[dimethyl(phenyl)silyl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 11318263 |
| Molecular Formula | C32H42O2Si2 |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | (3S,4R,5S)-4-[benzhydryl(dimethyl)silyl]-3-butyl-5-[[dimethyl(phenyl)silyl]methyl]oxolan-2-one |
| SMILES | CCCC[C@H]1C(=O)O[C@@H](C[Si](C)(C)c2ccccc2)[C@@H]1[Si](C)(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H42O2Si2/c1-6-7-23-28-31(29(34-32(28)33)24-35(2,3)27-21-15-10-16-22-27)36(4,5)30(25-17-11-8-12-18-25)26-19-13-9-14-20-26/h8-22,28-31H,6-7,23-24H2,1-5H3/t28-,29+,31-/m1/s1 |
| InChIKey | JICSQCMKQRNGHQ-ATNBEAFSSA-N |
| XLogP | 7.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|