C23H36O3 — CID 11842892
(3S,4S)-3-hexyl-4-[(2S)-2-phenylmethoxyheptyl]oxetan-2-one (PubChem CID 11842892) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3S,4S)-3-hexyl-4-[(2S)-2-phenylmethoxyheptyl]oxetan-2-one.
| Compound Name | (3S,4S)-3-hexyl-4-[(2S)-2-phenylmethoxyheptyl]oxetan-2-one |
|---|---|
| PubChem CID | 11842892 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3S,4S)-3-hexyl-4-[(2S)-2-phenylmethoxyheptyl]oxetan-2-one |
| SMILES | CCCCCC[C@@H]1C(=O)O[C@H]1C[C@H](CCCCC)OCc1ccccc1 |
| InChI | InChI=1S/C23H36O3/c1-3-5-7-12-16-21-22(26-23(21)24)17-20(15-9-6-4-2)25-18-19-13-10-8-11-14-19/h8,10-11,13-14,20-22H,3-7,9,12,15-18H2,1-2H3/t20-,21-,22-/m0/s1 |
| InChIKey | HOYIRUCGYONWKC-FKBYEOEOSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|