C25H42O3Si — CID 11633116
(3S,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-[hydroxy(phenyl)methyl]-6-propan-2-yloxan-2-one (PubChem CID 11633116) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is (3S,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-[hydroxy(phenyl)methyl]-6-propan-2-yloxan-2-one.
| Compound Name | (3S,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-[hydroxy(phenyl)methyl]-6-propan-2-yloxan-2-one |
|---|---|
| PubChem CID | 11633116 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (3S,4R,5S,6R)-4-butyl-5-[tert-butyl(dimethyl)silyl]-3-[hydroxy(phenyl)methyl]-6-propan-2-yloxan-2-one |
| SMILES | CCCC[C@H]1[C@H]([Si](C)(C)C(C)(C)C)[C@@H](C(C)C)OC(=O)[C@@H]1C(O)c1ccccc1 |
| InChI | InChI=1S/C25H42O3Si/c1-9-10-16-19-20(21(26)18-14-12-11-13-15-18)24(27)28-22(17(2)3)23(19)29(7,8)25(4,5)6/h11-15,17,19-23,26H,9-10,16H2,1-8H3/t19-,20+,21?,22-,23+/m1/s1 |
| InChIKey | WWJHWDILZKOPBD-IEMWQLIPSA-N |
| XLogP | 6.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|