C14H19LiSi — CID 174773742
lithium;cyclopenta-2,4-dien-1-ylmethyl-dimethyl-phenylsilane;hydride (PubChem CID 174773742) has the molecular formula C14H19LiSi and a molecular weight of 222.33 g/mol. Its IUPAC name is lithium;cyclopenta-2,4-dien-1-ylmethyl-dimethyl-phenylsilane;hydride.
| Compound Name | lithium;cyclopenta-2,4-dien-1-ylmethyl-dimethyl-phenylsilane;hydride |
|---|---|
| PubChem CID | 174773742 |
| Molecular Formula | C14H19LiSi |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | lithium;cyclopenta-2,4-dien-1-ylmethyl-dimethyl-phenylsilane;hydride |
| SMILES | C[Si](C)(CC1C=CC=C1)c1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C14H18Si.Li.H/c1-15(2,12-13-8-6-7-9-13)14-10-4-3-5-11-14;;/h3-11,13H,12H2,1-2H3;;/q;+1;-1 |
| InChIKey | UNXKFRKYPLIMGA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|