C15H25NOSi — CID 117062808
(2,6-dimethylmorpholin-4-yl)methyl-dimethyl-phenylsilane (PubChem CID 117062808) has the molecular formula C15H25NOSi and a molecular weight of 263.46 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)methyl-dimethyl-phenylsilane.
| Compound Name | (2,6-dimethylmorpholin-4-yl)methyl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 117062808 |
| Molecular Formula | C15H25NOSi |
| Molecular Weight | 263.46 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)methyl-dimethyl-phenylsilane |
| SMILES | CC1CN(C[Si](C)(C)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C15H25NOSi/c1-13-10-16(11-14(2)17-13)12-18(3,4)15-8-6-5-7-9-15/h5-9,13-14H,10-12H2,1-4H3 |
| InChIKey | XLEPJIHXZBUHPY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|