C14H21NO2S — CID 95149940
(2S,6R)-2,6-dimethyl-4-[2-[(R)-phenylsulfinyl]ethyl]morpholine (PubChem CID 95149940) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-[2-[(R)-phenylsulfinyl]ethyl]morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-[2-[(R)-phenylsulfinyl]ethyl]morpholine |
|---|---|
| PubChem CID | 95149940 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-[2-[(R)-phenylsulfinyl]ethyl]morpholine |
| SMILES | C[C@@H]1CN(CC[S@@](=O)c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H21NO2S/c1-12-10-15(11-13(2)17-12)8-9-18(16)14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3/t12-,13+,18-/m1/s1 |
| InChIKey | DOIFQUFSQPZMCU-FHSNZYRGSA-N |
| XLogP | 1.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |