C18H27N3O2S — CID 95298457
[4-[2-[(R)-phenylsulfinyl]ethyl]piperazin-1-yl]-piperidin-1-ylmethanone (PubChem CID 95298457) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is [4-[2-[(R)-phenylsulfinyl]ethyl]piperazin-1-yl]-piperidin-1-ylmethanone.
| Compound Name | [4-[2-[(R)-phenylsulfinyl]ethyl]piperazin-1-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 95298457 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | [4-[2-[(R)-phenylsulfinyl]ethyl]piperazin-1-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)N1CCN(CC[S@@](=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O2S/c22-18(20-9-5-2-6-10-20)21-13-11-19(12-14-21)15-16-24(23)17-7-3-1-4-8-17/h1,3-4,7-8H,2,5-6,9-16H2/t24-/m1/s1 |
| InChIKey | BHHNYDFXHPGHHJ-XMMPIXPASA-N |
| XLogP | 2.02 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |