C14H22ClNOS — CID 3053263
1-[2-(benzenesulfinyl)ethyl]azepane;hydrochloride (PubChem CID 3053263) has the molecular formula C14H22ClNOS and a molecular weight of 287.86 g/mol. Its IUPAC name is 1-[2-(benzenesulfinyl)ethyl]azepane;hydrochloride.
| Compound Name | 1-[2-(benzenesulfinyl)ethyl]azepane;hydrochloride |
|---|---|
| PubChem CID | 3053263 |
| Molecular Formula | C14H22ClNOS |
| Molecular Weight | 287.86 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-[2-(benzenesulfinyl)ethyl]azepane;hydrochloride |
| SMILES | Cl.O=S(CCN1CCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H21NOS.ClH/c16-17(14-8-4-3-5-9-14)13-12-15-10-6-1-2-7-11-15;/h3-5,8-9H,1-2,6-7,10-13H2;1H |
| InChIKey | KPWWUZKIHLBHFN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |