C16H32N4O — CID 79157476
[4-(4-aminobutyl)-1,4-diazepan-1-yl]-(azepan-1-yl)methanone (PubChem CID 79157476) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(azepan-1-yl)methanone.
| Compound Name | [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(azepan-1-yl)methanone |
|---|---|
| PubChem CID | 79157476 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(azepan-1-yl)methanone |
| SMILES | NCCCCN1CCCN(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C16H32N4O/c17-8-3-6-9-18-10-7-13-20(15-14-18)16(21)19-11-4-1-2-5-12-19/h1-15,17H2 |
| InChIKey | RWKZPHKFFYCYMU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|