C21H25N3O2 — CID 1488902
N-(benzhydrylideneamino)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]acetamide (PubChem CID 1488902) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(benzhydrylideneamino)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]acetamide.
| Compound Name | N-(benzhydrylideneamino)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 1488902 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(benzhydrylideneamino)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]acetamide |
| SMILES | C[C@@H]1CN(CC(=O)NN=C(c2ccccc2)c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H25N3O2/c1-16-13-24(14-17(2)26-16)15-20(25)22-23-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,16-17H,13-15H2,1-2H3,(H,22,25)/t16-,17+ |
| InChIKey | CGMYGPAGIWQBBA-CALCHBBNSA-N |
| XLogP | 2.66 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|