C15H20N2O4 — CID 102935865
N-[2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetyl]benzamide (PubChem CID 102935865) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetyl]benzamide.
| Compound Name | N-[2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetyl]benzamide |
|---|---|
| PubChem CID | 102935865 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetyl]benzamide |
| SMILES | CC1CN(CC(=O)NC(=O)c2ccccc2)CC(CO)O1 |
| InChI | InChI=1S/C15H20N2O4/c1-11-7-17(8-13(10-18)21-11)9-14(19)16-15(20)12-5-3-2-4-6-12/h2-6,11,13,18H,7-10H2,1H3,(H,16,19,20) |
| InChIKey | YFNVEENRQGCUCU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |