C10H19N3O4 — CID 102936068
N'-acetyl-2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetohydrazide (PubChem CID 102936068) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is N'-acetyl-2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetohydrazide.
| Compound Name | N'-acetyl-2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 102936068 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N'-acetyl-2-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CN1CC(C)OC(CO)C1 |
| InChI | InChI=1S/C10H19N3O4/c1-7-3-13(4-9(6-14)17-7)5-10(16)12-11-8(2)15/h7,9,14H,3-6H2,1-2H3,(H,11,15)(H,12,16) |
| InChIKey | XLQVGZWRXSABQE-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|