C15H21N5O — CID 94017565
(2S,6R)-4-[(1-benzyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine (PubChem CID 94017565) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is (2S,6R)-4-[(1-benzyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[(1-benzyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 94017565 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (2S,6R)-4-[(1-benzyltetrazol-5-yl)methyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(Cc2nnnn2Cc2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H21N5O/c1-12-8-19(9-13(2)21-12)11-15-16-17-18-20(15)10-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3/t12-,13+ |
| InChIKey | BKAMCGZCABHTJP-BETUJISGSA-N |
| XLogP | 1.33 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |