C14H18Si — CID 174662773
cyclopenta-2,4-dien-1-yl-ethyl-methyl-phenylsilane (PubChem CID 174662773) has the molecular formula C14H18Si and a molecular weight of 214.38 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-ethyl-methyl-phenylsilane.
| Compound Name | cyclopenta-2,4-dien-1-yl-ethyl-methyl-phenylsilane |
|---|---|
| PubChem CID | 174662773 |
| Molecular Formula | C14H18Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-ethyl-methyl-phenylsilane |
| SMILES | CC[Si](C)(c1ccccc1)C1C=CC=C1 |
| InChI | InChI=1S/C14H18Si/c1-3-15(2,14-11-7-8-12-14)13-9-5-4-6-10-13/h4-12,14H,3H2,1-2H3 |
| InChIKey | UKUFNYOHGIIFLQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|