C15H20Si — CID 173383828
(2-ethylcyclopenta-2,4-dien-1-yl)-dimethyl-phenylsilane (PubChem CID 173383828) has the molecular formula C15H20Si and a molecular weight of 228.41 g/mol. Its IUPAC name is (2-ethylcyclopenta-2,4-dien-1-yl)-dimethyl-phenylsilane.
| Compound Name | (2-ethylcyclopenta-2,4-dien-1-yl)-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 173383828 |
| Molecular Formula | C15H20Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (2-ethylcyclopenta-2,4-dien-1-yl)-dimethyl-phenylsilane |
| SMILES | CCC1=CC=CC1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H20Si/c1-4-13-9-8-12-15(13)16(2,3)14-10-6-5-7-11-14/h5-12,15H,4H2,1-3H3 |
| InChIKey | SVJPAYWYOGYDLL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|