C21H27Ga — CID 90472027
tris(2-ethylcyclopenta-2,4-dien-1-yl)gallane (PubChem CID 90472027) has the molecular formula C21H27Ga and a molecular weight of 349.17 g/mol. Its IUPAC name is tris(2-ethylcyclopenta-2,4-dien-1-yl)gallane.
| Compound Name | tris(2-ethylcyclopenta-2,4-dien-1-yl)gallane |
|---|---|
| PubChem CID | 90472027 |
| Molecular Formula | C21H27Ga |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | tris(2-ethylcyclopenta-2,4-dien-1-yl)gallane |
| SMILES | CCC1=CC=CC1[Ga](C1C=CC=C1CC)C1C=CC=C1CC |
| InChI | InChI=1S/3C7H9.Ga/c3*1-2-7-5-3-4-6-7;/h3*3-6H,2H2,1H3; |
| InChIKey | ZCSQHNHPRXJDFR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |