About [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene
[(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene (PubChem CID 141345784) has the molecular formula C20H20
and a molecular weight of 260.38 g/mol. Its IUPAC name is [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene.
Molecular Properties
| Compound Name | [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene |
| PubChem CID | 141345784 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene |
| SMILES | CCC1=CC=CC1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20/c1-2-16-14-9-15-19(16)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-15,19-20H,2H2,1H3 |
| InChIKey | VYOWWSSKBRLTTH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene?
The IUPAC name of [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene (CID 141345784) is [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene.
What is the SMILES notation for [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene?
The canonical SMILES for [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene is CCC1=CC=CC1C(c1ccccc1)c1ccccc1.
What is the InChIKey of [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene?
The InChIKey is VYOWWSSKBRLTTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20/c1-2-16-14-9-15-19(16)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-15,19-20H,2H2,1H3.
What are the key properties of [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene?
[(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene has a molecular weight of 260.38 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-ethylcyclopenta-2,4-dien-1-yl)-phenylmethyl]benzene is sourced from PubChem (CID 141345784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).