C20H18 — CID 154090112
5-benzhydryl-6-methylidenecyclohexa-1,3-diene (PubChem CID 154090112) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 5-benzhydryl-6-methylidenecyclohexa-1,3-diene.
| Compound Name | 5-benzhydryl-6-methylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154090112 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-benzhydryl-6-methylidenecyclohexa-1,3-diene |
| SMILES | C=C1C=CC=CC1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-15,19-20H,1H2 |
| InChIKey | IIYKKLPAWUTVPI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |