C27H28NP — CID 87708719
(1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)-N-[(1S)-1-phenylethyl]ethanamine (PubChem CID 87708719) has the molecular formula C27H28NP and a molecular weight of 397.50 g/mol. Its IUPAC name is (1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)-N-[(1S)-1-phenylethyl]ethanamine.
| Compound Name | (1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)-N-[(1S)-1-phenylethyl]ethanamine |
|---|---|
| PubChem CID | 87708719 |
| Molecular Formula | C27H28NP |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (1R)-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)-N-[(1S)-1-phenylethyl]ethanamine |
| SMILES | C[C@H](N[C@H](C)C1C=CC=C1P(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28NP/c1-21(23-13-6-3-7-14-23)28-22(2)26-19-12-20-27(26)29(24-15-8-4-9-16-24)25-17-10-5-11-18-25/h3-22,26,28H,1-2H3/t21-,22+,26?/m0/s1 |
| InChIKey | WOHJONSSLDINJI-SMWUWQHRSA-N |
| XLogP | 5.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|