C26H24NOP — CID 101436749
2-diphenylphosphanyl-N-[(1R)-1-phenylethyl]cyclopenta-2,4-diene-1-carboxamide (PubChem CID 101436749) has the molecular formula C26H24NOP and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N-[(1R)-1-phenylethyl]cyclopenta-2,4-diene-1-carboxamide.
| Compound Name | 2-diphenylphosphanyl-N-[(1R)-1-phenylethyl]cyclopenta-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 101436749 |
| Molecular Formula | C26H24NOP |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-diphenylphosphanyl-N-[(1R)-1-phenylethyl]cyclopenta-2,4-diene-1-carboxamide |
| SMILES | C[C@@H](NC(=O)C1C=CC=C1P(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24NOP/c1-20(21-12-5-2-6-13-21)27-26(28)24-18-11-19-25(24)29(22-14-7-3-8-15-22)23-16-9-4-10-17-23/h2-20,24H,1H3,(H,27,28)/t20-,24?/m1/s1 |
| InChIKey | MVGUJXZUFFBAOR-CGHJUBPDSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|