C39H38P2 — CID 102041384
[(1R)-5-cyclopenta-2,4-dien-1-yl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)pentyl]-diphenylphosphane (PubChem CID 102041384) has the molecular formula C39H38P2 and a molecular weight of 568.68 g/mol. Its IUPAC name is [(1R)-5-cyclopenta-2,4-dien-1-yl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)pentyl]-diphenylphosphane.
| Compound Name | [(1R)-5-cyclopenta-2,4-dien-1-yl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)pentyl]-diphenylphosphane |
|---|---|
| PubChem CID | 102041384 |
| Molecular Formula | C39H38P2 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | [(1R)-5-cyclopenta-2,4-dien-1-yl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)pentyl]-diphenylphosphane |
| SMILES | C1=CC(CCCC[C@H](C2C=CC=C2P(c2ccccc2)c2ccccc2)P(c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C39H38P2/c1-5-21-33(22-6-1)40(34-23-7-2-8-24-34)38(30-16-15-20-32-18-13-14-19-32)37-29-17-31-39(37)41(35-25-9-3-10-26-35)36-27-11-4-12-28-36/h1-14,17-19,21-29,31-32,37-38H,15-16,20,30H2/t37?,38-/m1/s1 |
| InChIKey | DVIWWELGLXQCQC-YWIOZPJLSA-N |
| XLogP | 8.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|