C35H40P2 — CID 71310349
ditert-butyl-[(1R)-1-(2-dinaphthalen-1-ylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane (PubChem CID 71310349) has the molecular formula C35H40P2 and a molecular weight of 522.65 g/mol. Its IUPAC name is ditert-butyl-[(1R)-1-(2-dinaphthalen-1-ylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane.
| Compound Name | ditert-butyl-[(1R)-1-(2-dinaphthalen-1-ylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane |
|---|---|
| PubChem CID | 71310349 |
| Molecular Formula | C35H40P2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | ditert-butyl-[(1R)-1-(2-dinaphthalen-1-ylphosphanylcyclopenta-2,4-dien-1-yl)ethyl]phosphane |
| SMILES | C[C@H](C1C=CC=C1P(c1cccc2ccccc12)c1cccc2ccccc12)P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C35H40P2/c1-25(37(34(2,3)4)35(5,6)7)28-21-14-24-31(28)36(32-22-12-17-26-15-8-10-19-29(26)32)33-23-13-18-27-16-9-11-20-30(27)33/h8-25,28H,1-7H3/t25-,28?/m1/s1 |
| InChIKey | YGQKRDFSZFAHNJ-RXVAYIKUSA-N |
| XLogP | 9.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|