C36H38N3PS — CID 118687818
1-[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-3-[(1R)-1-[(1S)-2-diphenylphosphanylcyclopenta-2,4-dien-1-yl]ethyl]thiourea (PubChem CID 118687818) has the molecular formula C36H38N3PS and a molecular weight of 575.76 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-3-[(1R)-1-[(1S)-2-diphenylphosphanylcyclopenta-2,4-dien-1-yl]ethyl]thiourea.
| Compound Name | 1-[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-3-[(1R)-1-[(1S)-2-diphenylphosphanylcyclopenta-2,4-dien-1-yl]ethyl]thiourea |
|---|---|
| PubChem CID | 118687818 |
| Molecular Formula | C36H38N3PS |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 1-[(1S,2S)-2-(dimethylamino)-1,2-diphenylethyl]-3-[(1R)-1-[(1S)-2-diphenylphosphanylcyclopenta-2,4-dien-1-yl]ethyl]thiourea |
| SMILES | C[C@@H](NC(=S)N[C@@H](c1ccccc1)[C@H](c1ccccc1)N(C)C)[C@@H]1C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H38N3PS/c1-27(32-25-16-26-33(32)40(30-21-12-6-13-22-30)31-23-14-7-15-24-31)37-36(41)38-34(28-17-8-4-9-18-28)35(39(2)3)29-19-10-5-11-20-29/h4-27,32,34-35H,1-3H3,(H2,37,38,41)/t27-,32+,34+,35+/m1/s1 |
| InChIKey | MRQFYMBTBNTARA-OADAKKCXSA-N |
| XLogP | 7.09 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|