C17H22N2 — CID 11448338
(1S,2S)-N,N,N'-trimethyl-1,2-diphenylethane-1,2-diamine (PubChem CID 11448338) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (1S,2S)-N,N,N'-trimethyl-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1S,2S)-N,N,N'-trimethyl-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 11448338 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (1S,2S)-N,N,N'-trimethyl-1,2-diphenylethane-1,2-diamine |
| SMILES | CN[C@@H](c1ccccc1)[C@H](c1ccccc1)N(C)C |
| InChI | InChI=1S/C17H22N2/c1-18-16(14-10-6-4-7-11-14)17(19(2)3)15-12-8-5-9-13-15/h4-13,16-18H,1-3H3/t16-,17-/m0/s1 |
| InChIKey | GJUJCWHBPKCRID-IRXDYDNUSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |