C14H18 — CID 123465599
5-ethyl-1,4-dimethyl-4a,8a-dihydronaphthalene (PubChem CID 123465599) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 5-ethyl-1,4-dimethyl-4a,8a-dihydronaphthalene.
| Compound Name | 5-ethyl-1,4-dimethyl-4a,8a-dihydronaphthalene |
|---|---|
| PubChem CID | 123465599 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 5-ethyl-1,4-dimethyl-4a,8a-dihydronaphthalene |
| SMILES | CCC1=CC=CC2C(C)=CC=C(C)C12 |
| InChI | InChI=1S/C14H18/c1-4-12-6-5-7-13-10(2)8-9-11(3)14(12)13/h5-9,13-14H,4H2,1-3H3 |
| InChIKey | VXQVNCOHVTYCIE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |