About 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine
1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine (PubChem CID 89297059) has the molecular formula C21H19N
and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine.
Molecular Properties
| Compound Name | 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine |
| PubChem CID | 89297059 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine |
| SMILES | CC1=CC=C2C=CC=CC2[C@H]1c1c(N)ccc2ccccc12 |
| InChI | InChI=1S/C21H19N/c1-14-10-11-15-6-2-4-8-17(15)20(14)21-18-9-5-3-7-16(18)12-13-19(21)22/h2-13,17,20H,22H2,1H3/t17?,20-/m0/s1 |
| InChIKey | AMOGVVXLCPTXDK-OZBJMMHXSA-N |
| XLogP | 5.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine?
The IUPAC name of 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine (CID 89297059) is 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine.
What is the SMILES notation for 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine?
The canonical SMILES for 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine is CC1=CC=C2C=CC=CC2[C@H]1c1c(N)ccc2ccccc12.
What is the InChIKey of 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine?
The InChIKey is AMOGVVXLCPTXDK-OZBJMMHXSA-N. The full InChI is InChI=1S/C21H19N/c1-14-10-11-15-6-2-4-8-17(15)20(14)21-18-9-5-3-7-16(18)12-13-19(21)22/h2-13,17,20H,22H2,1H3/t17?,20-/m0/s1.
What are the key properties of 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine?
1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine has a molecular weight of 285.39 g/mol, XLogP of 5.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-2-methyl-1,8a-dihydronaphthalen-1-yl]naphthalen-2-amine is sourced from PubChem (CID 89297059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).