About (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane
(3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173384079) has the molecular formula C21H24Si
and a molecular weight of 304.51 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane.
Molecular Properties
| Compound Name | (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane |
| PubChem CID | 173384079 |
| Molecular Formula | C21H24Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | Cc1cc(C)cc([Si](C)(C)C2C=CC=C2c2ccccc2)c1 |
| InChI | InChI=1S/C21H24Si/c1-16-13-17(2)15-19(14-16)22(3,4)21-12-8-11-20(21)18-9-6-5-7-10-18/h5-15,21H,1-4H3 |
| InChIKey | WBLCREKBUWGOAQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane?
The IUPAC name of (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane (CID 173384079) is (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane.
What is the SMILES notation for (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane?
The canonical SMILES for (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane is Cc1cc(C)cc([Si](C)(C)C2C=CC=C2c2ccccc2)c1.
What is the InChIKey of (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane?
The InChIKey is WBLCREKBUWGOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Si/c1-16-13-17(2)15-19(14-16)22(3,4)21-12-8-11-20(21)18-9-6-5-7-10-18/h5-15,21H,1-4H3.
What are the key properties of (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane?
(3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane has a molecular weight of 304.51 g/mol, XLogP of 5.24, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylphenyl)-dimethyl-(2-phenylcyclopenta-2,4-dien-1-yl)silane is sourced from PubChem (CID 173384079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).