About (5-ethynylcyclopenta-1,3-dien-1-yl)benzene
(5-ethynylcyclopenta-1,3-dien-1-yl)benzene (PubChem CID 172765009) has the molecular formula C13H10
and a molecular weight of 166.22 g/mol. Its IUPAC name is (5-ethynylcyclopenta-1,3-dien-1-yl)benzene.
Molecular Properties
| Compound Name | (5-ethynylcyclopenta-1,3-dien-1-yl)benzene |
| PubChem CID | 172765009 |
| Molecular Formula | C13H10 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (5-ethynylcyclopenta-1,3-dien-1-yl)benzene |
| SMILES | C#CC1C=CC=C1c1ccccc1 |
| InChI | InChI=1S/C13H10/c1-2-11-9-6-10-13(11)12-7-4-3-5-8-12/h1,3-11H |
| InChIKey | MGEAQDKGUYKSEC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-ethynylcyclopenta-1,3-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethynylcyclopenta-1,3-dien-1-yl)benzene?
The IUPAC name of (5-ethynylcyclopenta-1,3-dien-1-yl)benzene (CID 172765009) is (5-ethynylcyclopenta-1,3-dien-1-yl)benzene.
What is the SMILES notation for (5-ethynylcyclopenta-1,3-dien-1-yl)benzene?
The canonical SMILES for (5-ethynylcyclopenta-1,3-dien-1-yl)benzene is C#CC1C=CC=C1c1ccccc1.
What is the InChIKey of (5-ethynylcyclopenta-1,3-dien-1-yl)benzene?
The InChIKey is MGEAQDKGUYKSEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10/c1-2-11-9-6-10-13(11)12-7-4-3-5-8-12/h1,3-11H.
What are the key properties of (5-ethynylcyclopenta-1,3-dien-1-yl)benzene?
(5-ethynylcyclopenta-1,3-dien-1-yl)benzene has a molecular weight of 166.22 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethynylcyclopenta-1,3-dien-1-yl)benzene is sourced from PubChem (CID 172765009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).