C17H14S — CID 154137759
2,3-diphenyl-2H-thiopyran (PubChem CID 154137759) has the molecular formula C17H14S and a molecular weight of 250.37 g/mol. Its IUPAC name is 2,3-diphenyl-2H-thiopyran.
| Compound Name | 2,3-diphenyl-2H-thiopyran |
|---|---|
| PubChem CID | 154137759 |
| Molecular Formula | C17H14S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2,3-diphenyl-2H-thiopyran |
| SMILES | C1=CSC(c2ccccc2)C(c2ccccc2)=C1 |
| InChI | InChI=1S/C17H14S/c1-3-8-14(9-4-1)16-12-7-13-18-17(16)15-10-5-2-6-11-15/h1-13,17H |
| InChIKey | XIUHMWLVNFUAOH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |