C16H14S — CID 14921583
3,4-diphenyl-2,3-dihydrothiophene (PubChem CID 14921583) has the molecular formula C16H14S and a molecular weight of 238.36 g/mol. Its IUPAC name is 3,4-diphenyl-2,3-dihydrothiophene.
| Compound Name | 3,4-diphenyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 14921583 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3,4-diphenyl-2,3-dihydrothiophene |
| SMILES | C1=C(c2ccccc2)C(c2ccccc2)CS1 |
| InChI | InChI=1S/C16H14S/c1-3-7-13(8-4-1)15-11-17-12-16(15)14-9-5-2-6-10-14/h1-11,16H,12H2 |
| InChIKey | RSRJVZHNJFVCFA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |