C17H16O2 — CID 123868497
4,5-diphenyl-4,7-dihydro-1,3-dioxepine (PubChem CID 123868497) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4,5-diphenyl-4,7-dihydro-1,3-dioxepine.
| Compound Name | 4,5-diphenyl-4,7-dihydro-1,3-dioxepine |
|---|---|
| PubChem CID | 123868497 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4,5-diphenyl-4,7-dihydro-1,3-dioxepine |
| SMILES | C1=C(c2ccccc2)C(c2ccccc2)OCOC1 |
| InChI | InChI=1S/C17H16O2/c1-3-7-14(8-4-1)16-11-12-18-13-19-17(16)15-9-5-2-6-10-15/h1-11,17H,12-13H2 |
| InChIKey | UCUZSVRYJOAVMF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |