C10H11ClO2 — CID 95562202
(4S,5S)-5-chloro-4-phenyl-1,3-dioxane (PubChem CID 95562202) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is (4S,5S)-5-chloro-4-phenyl-1,3-dioxane.
| Compound Name | (4S,5S)-5-chloro-4-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 95562202 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (4S,5S)-5-chloro-4-phenyl-1,3-dioxane |
| SMILES | Cl[C@H]1COCO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H11ClO2/c11-9-6-12-7-13-10(9)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2/t9-,10-/m0/s1 |
| InChIKey | OPNBZWUBRPHXOR-UWVGGRQHSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|