C15H14O3 — CID 11831593
4-[(4R,5S)-5-phenyl-1,3-dioxolan-4-yl]phenol (PubChem CID 11831593) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-[(4R,5S)-5-phenyl-1,3-dioxolan-4-yl]phenol.
| Compound Name | 4-[(4R,5S)-5-phenyl-1,3-dioxolan-4-yl]phenol |
|---|---|
| PubChem CID | 11831593 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-[(4R,5S)-5-phenyl-1,3-dioxolan-4-yl]phenol |
| SMILES | Oc1ccc([C@H]2OCO[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14O3/c16-13-8-6-12(7-9-13)15-14(17-10-18-15)11-4-2-1-3-5-11/h1-9,14-16H,10H2/t14-,15+/m0/s1 |
| InChIKey | CWOASYBQJGEZOQ-LSDHHAIUSA-N |
| XLogP | 3.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |