About 4-bromo-5-phenyl-1,3-dioxolane
4-bromo-5-phenyl-1,3-dioxolane (PubChem CID 69060625) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is 4-bromo-5-phenyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-bromo-5-phenyl-1,3-dioxolane |
| PubChem CID | 69060625 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 4-bromo-5-phenyl-1,3-dioxolane |
| SMILES | BrC1OCOC1c1ccccc1 |
| InChI | InChI=1S/C9H9BrO2/c10-9-8(11-6-12-9)7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | HDADNOVJLQNWPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-phenyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-phenyl-1,3-dioxolane?
The IUPAC name of 4-bromo-5-phenyl-1,3-dioxolane (CID 69060625) is 4-bromo-5-phenyl-1,3-dioxolane.
What is the SMILES notation for 4-bromo-5-phenyl-1,3-dioxolane?
The canonical SMILES for 4-bromo-5-phenyl-1,3-dioxolane is BrC1OCOC1c1ccccc1.
What is the InChIKey of 4-bromo-5-phenyl-1,3-dioxolane?
The InChIKey is HDADNOVJLQNWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2/c10-9-8(11-6-12-9)7-4-2-1-3-5-7/h1-5,8-9H,6H2.
What are the key properties of 4-bromo-5-phenyl-1,3-dioxolane?
4-bromo-5-phenyl-1,3-dioxolane has a molecular weight of 229.07 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-phenyl-1,3-dioxolane is sourced from PubChem (CID 69060625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).