C10H13NO2 — CID 11116629
(4R,5R)-4-phenyl-1,3-dioxan-5-amine (PubChem CID 11116629) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (4R,5R)-4-phenyl-1,3-dioxan-5-amine.
| Compound Name | (4R,5R)-4-phenyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 11116629 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4R,5R)-4-phenyl-1,3-dioxan-5-amine |
| SMILES | N[C@@H]1COCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c11-9-6-12-7-13-10(9)8-4-2-1-3-5-8/h1-5,9-10H,6-7,11H2/t9-,10-/m1/s1 |
| InChIKey | KNURWXWPWSONGI-NXEZZACHSA-N |
| XLogP | 1.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |