C11H13IO2 — CID 101367398
[(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol (PubChem CID 101367398) has the molecular formula C11H13IO2 and a molecular weight of 304.13 g/mol. Its IUPAC name is [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol.
| Compound Name | [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol |
|---|---|
| PubChem CID | 101367398 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol |
| SMILES | OC[C@@H]1CO[C@@H](c2ccccc2)C1I |
| InChI | InChI=1S/C11H13IO2/c12-10-9(6-13)7-14-11(10)8-4-2-1-3-5-8/h1-5,9-11,13H,6-7H2/t9-,10?,11+/m1/s1 |
| InChIKey | XRBXRXQCGDCNJD-FBKFWFMHSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|