About [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol
[(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol (PubChem CID 101367398) has the molecular formula C11H13IO2
and a molecular weight of 304.13 g/mol. Its IUPAC name is [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol |
| PubChem CID | 101367398 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol |
| SMILES | OC[C@@H]1CO[C@@H](c2ccccc2)C1I |
| InChI | InChI=1S/C11H13IO2/c12-10-9(6-13)7-14-11(10)8-4-2-1-3-5-8/h1-5,9-11,13H,6-7H2/t9-,10?,11+/m1/s1 |
| InChIKey | XRBXRXQCGDCNJD-FBKFWFMHSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol?
The IUPAC name of [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol (CID 101367398) is [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol.
What is the SMILES notation for [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol?
The canonical SMILES for [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol is OC[C@@H]1CO[C@@H](c2ccccc2)C1I.
What is the InChIKey of [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol?
The InChIKey is XRBXRXQCGDCNJD-FBKFWFMHSA-N. The full InChI is InChI=1S/C11H13IO2/c12-10-9(6-13)7-14-11(10)8-4-2-1-3-5-8/h1-5,9-11,13H,6-7H2/t9-,10?,11+/m1/s1.
What are the key properties of [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol?
[(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol has a molecular weight of 304.13 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-4-iodo-5-phenyloxolan-3-yl]methanol is sourced from PubChem (CID 101367398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).