C21H21NO — CID 98512869
(NE)-N-[(1S,4R,5S)-2,4-diphenyl-9-bicyclo[3.3.1]non-2-enylidene]hydroxylamine (PubChem CID 98512869) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is (NE)-N-[(1S,4R,5S)-2,4-diphenyl-9-bicyclo[3.3.1]non-2-enylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,4R,5S)-2,4-diphenyl-9-bicyclo[3.3.1]non-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 98512869 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (NE)-N-[(1S,4R,5S)-2,4-diphenyl-9-bicyclo[3.3.1]non-2-enylidene]hydroxylamine |
| SMILES | O/N=C1\[C@H]2CCC[C@H]1C(c1ccccc1)=C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C21H21NO/c23-22-21-17-12-7-13-18(21)20(16-10-5-2-6-11-16)14-19(17)15-8-3-1-4-9-15/h1-6,8-11,14,17-19,23H,7,12-13H2/b22-21+/t17-,18-,19-/m0/s1 |
| InChIKey | KGLSAEIHDAHOJC-CQSSKZMZSA-N |
| XLogP | 5.11 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|