C19H16 — CID 145063916
(6R)-2,5-diphenylbicyclo[4.1.0]hepta-2,4-diene (PubChem CID 145063916) has the molecular formula C19H16 and a molecular weight of 244.34 g/mol. Its IUPAC name is (6R)-2,5-diphenylbicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | (6R)-2,5-diphenylbicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 145063916 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (6R)-2,5-diphenylbicyclo[4.1.0]hepta-2,4-diene |
| SMILES | C1=C(c2ccccc2)C2C[C@H]2C(c2ccccc2)=C1 |
| InChI | InChI=1S/C19H16/c1-3-7-14(8-4-1)16-11-12-17(19-13-18(16)19)15-9-5-2-6-10-15/h1-12,18-19H,13H2/t18-,19?/m0/s1 |
| InChIKey | UQCCIVUBASYSPE-OYKVQYDMSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |