C16H17Br — CID 134944585
(8aS)-5-bromo-8-phenyl-1,2,3,4,4a,8a-hexahydronaphthalene (PubChem CID 134944585) has the molecular formula C16H17Br and a molecular weight of 289.22 g/mol. Its IUPAC name is (8aS)-5-bromo-8-phenyl-1,2,3,4,4a,8a-hexahydronaphthalene.
| Compound Name | (8aS)-5-bromo-8-phenyl-1,2,3,4,4a,8a-hexahydronaphthalene |
|---|---|
| PubChem CID | 134944585 |
| Molecular Formula | C16H17Br |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (8aS)-5-bromo-8-phenyl-1,2,3,4,4a,8a-hexahydronaphthalene |
| SMILES | BrC1=CC=C(c2ccccc2)[C@H]2CCCCC12 |
| InChI | InChI=1S/C16H17Br/c17-16-11-10-13(12-6-2-1-3-7-12)14-8-4-5-9-15(14)16/h1-3,6-7,10-11,14-15H,4-5,8-9H2/t14-,15?/m1/s1 |
| InChIKey | XUECEMWWNXDMAZ-GICMACPYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |