C18H20O — CID 134964645
(2S)-13-phenyl-11-oxatricyclo[7.2.2.02,7]trideca-7,12-diene (PubChem CID 134964645) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (2S)-13-phenyl-11-oxatricyclo[7.2.2.02,7]trideca-7,12-diene.
| Compound Name | (2S)-13-phenyl-11-oxatricyclo[7.2.2.02,7]trideca-7,12-diene |
|---|---|
| PubChem CID | 134964645 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2S)-13-phenyl-11-oxatricyclo[7.2.2.02,7]trideca-7,12-diene |
| SMILES | C1=C(c2ccccc2)C2C=C3CCCC[C@@H]3C1OC2 |
| InChI | InChI=1S/C18H20O/c1-2-6-13(7-3-1)17-11-18-16-9-5-4-8-14(16)10-15(17)12-19-18/h1-3,6-7,10-11,15-16,18H,4-5,8-9,12H2/t15?,16-,18?/m0/s1 |
| InChIKey | WXXVPSSMXMZJGC-PQUAAJSLSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|