C15H16 — CID 72500899
2-methyl-5-phenylbicyclo[2.2.2]octa-2,5-diene (PubChem CID 72500899) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-methyl-5-phenylbicyclo[2.2.2]octa-2,5-diene.
| Compound Name | 2-methyl-5-phenylbicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 72500899 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-methyl-5-phenylbicyclo[2.2.2]octa-2,5-diene |
| SMILES | CC1=CC2CCC1C=C2c1ccccc1 |
| InChI | InChI=1S/C15H16/c1-11-9-14-8-7-13(11)10-15(14)12-5-3-2-4-6-12/h2-6,9-10,13-14H,7-8H2,1H3 |
| InChIKey | SPTVMZWQCDNQEB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|