C15H18O3 — CID 18325913
ethyl 4-hydroxy-2-phenylcyclohex-2-ene-1-carboxylate (PubChem CID 18325913) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-phenylcyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-phenylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 18325913 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | ethyl 4-hydroxy-2-phenylcyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)C=C1c1ccccc1 |
| InChI | InChI=1S/C15H18O3/c1-2-18-15(17)13-9-8-12(16)10-14(13)11-6-4-3-5-7-11/h3-7,10,12-13,16H,2,8-9H2,1H3 |
| InChIKey | PIRQONMTCKSGPS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |